CAS 163750-76-3 appears in our catalog under these names: H–D–His(3–Me)–OH, H-D-His(3-Me)-OH, H-D-His(3-me)-oh, 95%, (R)-2-Amino-3-(1-methyl-1H-imidazol-5-yl)propanoic acid, 97%. Offered by: GLPBio, Iris Biotech, Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g, 100mg.
(2R)-2-amino-3-(3-methylimidazol-4-yl)propanoic acid (CAS 163750-76-3) is a chemical compound with the molecular formula C7H11N3O2 and a molecular weight of 169.18 g/mol. IUPAC name: (2R)-2-amino-3-(3-methylimidazol-4-yl)propanoic acid. InChIKey: JDHILDINMRGULE-ZCFIWIBFSA-N.
| Molecular formula | C7H11N3O2 |
|---|---|
| Molecular weight | 169.18 g/mol |
| IUPAC name | (2R)-2-amino-3-(3-methylimidazol-4-yl)propanoic acid |
| InChIKey | JDHILDINMRGULE-ZCFIWIBFSA-N |
| SMILES | CN1C=NC=C1C[C@H](C(=O)O)N |
Computed by PubChem (NCBI)