CAS 1448855-27-3 is the registry number for 1-(3-Chlorophenyl)-4-methyl-1H-pyrazol-5-amine, 97%. Offered by: AmBeed. Available pack sizes: 1g.
1-(3-chlorophenyl)-4-methylpyrazol-5-amine (CAS 1448855-27-3) is a chemical compound with the molecular formula C10H10ClN3 and a molecular weight of 207.66 g/mol. IUPAC name: 1-(3-chlorophenyl)-4-methylpyrazol-5-amine. InChIKey: FLGXAUMTPSVVNT-UHFFFAOYSA-N.
| Molecular formula | C10H10ClN3 |
|---|---|
| Molecular weight | 207.66 g/mol |
| IUPAC name | 1-(3-chlorophenyl)-4-methylpyrazol-5-amine |
| InChIKey | FLGXAUMTPSVVNT-UHFFFAOYSA-N |
| SMILES | CC1=C(N(N=C1)C2=CC(=CC=C2)Cl)N |
Computed by PubChem (NCBI)