Products 144889-08-7
CAS 144889-08-7 appears in our catalog under these names: (S)-2-Benzylpyrrolidine hydrochloride, 95%, (R)-2-Benzylpyrrolidine hydrochloride, 97%, (S)-2-Benzylpyrrolidine Hydrochloride, (R)-2-Benzylpyrrolidine hydrochloride, 97%, 97%, (S)-2-BENZYLPYRROLIDINE HCL, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 50mg, 0,5g.
(2S)-2-benzylpyrrolidine;hydrochloride (CAS 144889-08-7) is a chemical compound with the molecular formula C11H16ClN and a molecular weight of 197.70 g/mol. IUPAC name: (2S)-2-benzylpyrrolidine;hydrochloride. InChIKey: PSNHTTMLFMMVMP-MERQFXBCSA-N.
| Molecular formula | C11H16ClN |
|---|---|
| Molecular weight | 197.70 g/mol |
| IUPAC name | (2S)-2-benzylpyrrolidine;hydrochloride |
| InChIKey | PSNHTTMLFMMVMP-MERQFXBCSA-N |
| SMILES | C1C[C@H](NC1)CC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)