Products 1449290-34-9
CAS 1449290-34-9 is the registry number for 1-bromo-4-(difluoromethyl)-2,3-difluorobenzene, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-bromo-4-(difluoromethyl)-2,3-difluorobenzene (CAS 1449290-34-9) is a chemical compound with the molecular formula C7H3BrF4 and a molecular weight of 243.00 g/mol. IUPAC name: 1-bromo-4-(difluoromethyl)-2,3-difluorobenzene. InChIKey: VLFQARMMKXNFFE-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF4 |
|---|---|
| Molecular weight | 243.00 g/mol |
| IUPAC name | 1-bromo-4-(difluoromethyl)-2,3-difluorobenzene |
| InChIKey | VLFQARMMKXNFFE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(F)F)F)F)Br |
Computed by PubChem (NCBI)