Products 1449483-78-6
CAS 1449483-78-6 appears in our catalog under these names: PM–1, PM-1, 99.04%, PM-1, 99%. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 10mg, 100mg, 25mg, 5mg, 50mg, 100 mg, 10 mg, 50 mg.
3-[4-(1,3-benzothiazol-2-yl)anilino]propanoic acid (CAS 1449483-78-6) is a chemical compound with the molecular formula C16H14N2O2S and a molecular weight of 298.4 g/mol. IUPAC name: 3-[4-(1,3-benzothiazol-2-yl)anilino]propanoic acid. InChIKey: PWKDNGQJVGZGED-UHFFFAOYSA-N.
| Molecular formula | C16H14N2O2S |
|---|---|
| Molecular weight | 298.4 g/mol |
| IUPAC name | 3-[4-(1,3-benzothiazol-2-yl)anilino]propanoic acid |
| InChIKey | PWKDNGQJVGZGED-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(S2)C3=CC=C(C=C3)NCCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
orb2565461