CAS 1449598-86-0 appears in our catalog under these names: Risdiplam Impurity 14, 2-Chloro-7-fluoro-4H-pyrido[1,2-a]pyrimidin-4-one 98%, 2-Chloro-7-fluoro-4H-pyrido[1,2-a]pyrimidin-4-one, 98%, 98%, 2-Chloro-7-fluoro-4H-pyrido[1,2-a]pyrimidin-4-one, 98%. Offered by: Chemat Brand, Ambeed, Chemat, Fluorochem. Available pack sizes: on request, 250mg, 1g, 5g, 10g, 25g, 100g, 100mg.
2-chloro-7-fluoropyrido[1,2-a]pyrimidin-4-one (CAS 1449598-86-0) is a chemical compound with the molecular formula C8H4ClFN2O and a molecular weight of 198.58 g/mol. IUPAC name: 2-chloro-7-fluoropyrido[1,2-a]pyrimidin-4-one. InChIKey: KIWCBASVSPMPMF-UHFFFAOYSA-N.
| Molecular formula | C8H4ClFN2O |
|---|---|
| Molecular weight | 198.58 g/mol |
| IUPAC name | 2-chloro-7-fluoropyrido[1,2-a]pyrimidin-4-one |
| InChIKey | KIWCBASVSPMPMF-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=CC(=O)N2C=C1F)Cl |
Computed by PubChem (NCBI)