CAS 1566199-72-1 appears in our catalog under these names: 7-Chloro-8-fluoro-3,4-dihydroquinazolin-4-one, 95%, 7-Chloro-8-fluoro-3,4-dihydroquinazolin-4-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
7-chloro-8-fluoro-3H-quinazolin-4-one (CAS 1566199-72-1) is a chemical compound with the molecular formula C8H4ClFN2O and a molecular weight of 198.58 g/mol. IUPAC name: 7-chloro-8-fluoro-3H-quinazolin-4-one. InChIKey: BMSJIVBWHFDFBU-UHFFFAOYSA-N.
| Molecular formula | C8H4ClFN2O |
|---|---|
| Molecular weight | 198.58 g/mol |
| IUPAC name | 7-chloro-8-fluoro-3H-quinazolin-4-one |
| InChIKey | BMSJIVBWHFDFBU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1C(=O)NC=N2)F)Cl |
Computed by PubChem (NCBI)