CAS 1820711-18-9 is the registry number for 2-(4-Chloro-2-fluorophenyl)-1,3,4-oxadiazole, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-(4-chloro-2-fluorophenyl)-1,3,4-oxadiazole (CAS 1820711-18-9) is a chemical compound with the molecular formula C8H4ClFN2O and a molecular weight of 198.58 g/mol. IUPAC name: 2-(4-chloro-2-fluorophenyl)-1,3,4-oxadiazole. InChIKey: QSKOPXOPCFHULF-UHFFFAOYSA-N.
| Molecular formula | C8H4ClFN2O |
|---|---|
| Molecular weight | 198.58 g/mol |
| IUPAC name | 2-(4-chloro-2-fluorophenyl)-1,3,4-oxadiazole |
| InChIKey | QSKOPXOPCFHULF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)F)C2=NN=CO2 |
Computed by PubChem (NCBI)