CAS 2703753-05-1 is the registry number for 2-Chloro-3-fluoro-4H-pyrido[1,2-a]pyrimidin-4-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-3-fluoropyrido[1,2-a]pyrimidin-4-one (CAS 2703753-05-1) is a chemical compound with the molecular formula C8H4ClFN2O and a molecular weight of 198.58 g/mol. IUPAC name: 2-chloro-3-fluoropyrido[1,2-a]pyrimidin-4-one. InChIKey: HZFORMBXCVLTRY-UHFFFAOYSA-N.
| Molecular formula | C8H4ClFN2O |
|---|---|
| Molecular weight | 198.58 g/mol |
| IUPAC name | 2-chloro-3-fluoropyrido[1,2-a]pyrimidin-4-one |
| InChIKey | HZFORMBXCVLTRY-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=C(C(=O)N2C=C1)F)Cl |
Computed by PubChem (NCBI)