CAS 145038-52-4 appears in our catalog under these names: Fmoc–Asp–OMe, Fmoc-L-Asp-OMe, Fmoc-Asp-OMe 98%, L-Aspartic acid, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-, 1-methyl ester, 98%, 98%, Fmoc-Asp-OMe, 99.63%. Offered by: GLPBio, Iris Biotech, Ambeed, Chemat, MedChemExpress. Available pack sizes: 100g, 25g, 1g, 5g, 250mg, 10g, 500g, 1000g.
(3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methoxy-4-oxobutanoic acid (CAS 145038-52-4) is a chemical compound with the molecular formula C20H19NO6 and a molecular weight of 369.4 g/mol. IUPAC name: (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methoxy-4-oxobutanoic acid. InChIKey: UEUZUMRMWJUEMK-KRWDZBQOSA-N.
| Molecular formula | C20H19NO6 |
|---|---|
| Molecular weight | 369.4 g/mol |
| IUPAC name | (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methoxy-4-oxobutanoic acid |
| InChIKey | UEUZUMRMWJUEMK-KRWDZBQOSA-N |
| SMILES | COC(=O)[C@H](CC(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)