CAS 121343-82-6 appears in our catalog under these names: Fmoc–Glu–OH, Fmoc-L-Glu-OH, N-Fmoc-L-glutamic acid, 95% , Fmoc-Glu-OH, N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-glutamic Acid, >98.0%(HPLC)(T). Offered by: GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), Biosynth, TCI. Available pack sizes: 25g, 100g, 5g, 50g, 1g, 500g, 250g, 10g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanedioic acid (CAS 121343-82-6) is a chemical compound with the molecular formula C20H19NO6 and a molecular weight of 369.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanedioic acid. InChIKey: QEPWHIXHJNNGLU-KRWDZBQOSA-N.
| Molecular formula | C20H19NO6 |
|---|---|
| Molecular weight | 369.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanedioic acid |
| InChIKey | QEPWHIXHJNNGLU-KRWDZBQOSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)