CAS 171778-17-9 appears in our catalog under these names: Fmoc–Ser(Ac)–OH, Fmoc-Ser(Ac)-OH, Fmoc-Ser(Ac)-OH 97%, O-Acetyl-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-serine, 97%, 97%, Fmoc-Ser(Ac)-OH, 98.84%. Offered by: GLPBio, TargetMol, Ambeed, Chemat, MedChemExpress. Available pack sizes: 10g, 100g, 25g, 5g, 50mg, 500g, 250mg, 1g.
(2S)-3-acetyloxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 171778-17-9) is a chemical compound with the molecular formula C20H19NO6 and a molecular weight of 369.4 g/mol. IUPAC name: (2S)-3-acetyloxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: HSGIKRPBGCJRDB-SFHVURJKSA-N.
| Molecular formula | C20H19NO6 |
|---|---|
| Molecular weight | 369.4 g/mol |
| IUPAC name | (2S)-3-acetyloxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | HSGIKRPBGCJRDB-SFHVURJKSA-N |
| SMILES | CC(=O)OC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)