CAS 104091-09-0 appears in our catalog under these names: N–((9H–Fluoren–9–ylmethoxy)carbonyl)–D–glutamic Acid, Fmoc–D–Glu–OH, N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-D-glutamic Acid, >97.0%(HPLC)(T), Fmoc-D-Glu-OH 95%, Fmoc-D-Glu-OH, 98%, 98%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 500g, 5g, 1g, 10g, 500 g, 100 g.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanedioic acid (CAS 104091-09-0) is a chemical compound with the molecular formula C20H19NO6 and a molecular weight of 369.4 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanedioic acid. InChIKey: QEPWHIXHJNNGLU-QGZVFWFLSA-N.
| Molecular formula | C20H19NO6 |
|---|---|
| Molecular weight | 369.4 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanedioic acid |
| InChIKey | QEPWHIXHJNNGLU-QGZVFWFLSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)