CAS 145091-91-4 is the registry number for 5-Phenyl-1h-pyrazol-3-ol, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 5g.
5-phenyl-1,2-dihydropyrazol-3-one (CAS 145091-91-4) is a chemical compound with the molecular formula C9H8N2O and a molecular weight of 160.17 g/mol. IUPAC name: 5-phenyl-1,2-dihydropyrazol-3-one. InChIKey: YLHCQNBWOZXHIR-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O |
|---|---|
| Molecular weight | 160.17 g/mol |
| IUPAC name | 5-phenyl-1,2-dihydropyrazol-3-one |
| InChIKey | YLHCQNBWOZXHIR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=O)NN2 |
Computed by PubChem (NCBI)