CAS 145143-01-7 appears in our catalog under these names: N-(tert-butoxycarbonyl)glycine-2-13c-15n, 98% 98%atom%13C,98%atom%15N, N-(TERT-BUTOXYCARBONYL)GLYCINE-2-13C-15&. Offered by: Chemat Brand, Sigma-Aldrich. Available pack sizes: on request, 100MG.
2-[(2-methylpropan-2-yl)oxycarbonyl(15N)amino]acetic acid (CAS 145143-01-7) is a chemical compound with the molecular formula C7H13NO4 and a molecular weight of 177.17 g/mol. IUPAC name: 2-[(2-methylpropan-2-yl)oxycarbonyl(15N)amino]acetic acid. InChIKey: VRPJIFMKZZEXLR-ARERNSRJSA-N.
| Molecular formula | C7H13NO4 |
|---|---|
| Molecular weight | 177.17 g/mol |
| IUPAC name | 2-[(2-methylpropan-2-yl)oxycarbonyl(15N)amino]acetic acid |
| InChIKey | VRPJIFMKZZEXLR-ARERNSRJSA-N |
| SMILES | CC(C)(C)OC(=O)[15NH][13CH2]C(=O)O |
Computed by PubChem (NCBI)