CAS 97352-64-2 appears in our catalog under these names: N-(tert-butoxycarbonyl)glycine-1-13c, 98% 98%atom%13C, Boc-Glycine-13C. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, 1mg, 5mg.
2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (CAS 97352-64-2) is a chemical compound with the molecular formula C7H13NO4 and a molecular weight of 176.18 g/mol. IUPAC name: 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid. InChIKey: VRPJIFMKZZEXLR-HOSYLAQJSA-N.
| Molecular formula | C7H13NO4 |
|---|---|
| Molecular weight | 176.18 g/mol |
| IUPAC name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| InChIKey | VRPJIFMKZZEXLR-HOSYLAQJSA-N |
| SMILES | CC(C)(C)OC(=O)NC[13C](=O)O |
Computed by PubChem (NCBI)