CAS 145143-02-8 appears in our catalog under these names: N-Boc-glycine-13C, Boc-Glycine-2-13C. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 50mg, 100mg, 1mg, 5mg.
2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (CAS 145143-02-8) is a chemical compound with the molecular formula C7H13NO4 and a molecular weight of 176.18 g/mol. IUPAC name: 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid. InChIKey: VRPJIFMKZZEXLR-AZXPZELESA-N.
| Molecular formula | C7H13NO4 |
|---|---|
| Molecular weight | 176.18 g/mol |
| IUPAC name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| InChIKey | VRPJIFMKZZEXLR-AZXPZELESA-N |
| SMILES | CC(C)(C)OC(=O)N[13CH2]C(=O)O |
Computed by PubChem (NCBI)