Products 42492-65-9

CAS 42492-65-9 appears in our catalog under these names: N-((1,1-Dimethylethoxy)carbonyl)glycine-2,2-d2, Glycine-2,2-d2-N-t-BOC, 98 atom % D, min 98% Chemical Purity, Boc–Glycine–d2, Boc-Glycine-d2, 98.0%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 1g, 0,5g, 100mg, 100 mg, 50 mg.

Structural formula: {0} (CAS {1})

2,2-dideuterio-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (CAS 42492-65-9) is a chemical compound with the molecular formula C7H13NO4 and a molecular weight of 177.19 g/mol. IUPAC name: 2,2-dideuterio-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid. InChIKey: VRPJIFMKZZEXLR-APZFVMQVSA-N.

Identity
Molecular formulaC7H13NO4
Molecular weight177.19 g/mol
IUPAC name2,2-dideuterio-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid
InChIKeyVRPJIFMKZZEXLR-APZFVMQVSA-N
SMILES[2H]C([2H])(C(=O)O)NC(=O)OC(C)(C)C

Computed by PubChem (NCBI)