Products 14517-66-9
CAS 14517-66-9 is the registry number for Acetyl-D-glutamine-d5. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2R)-2-acetamido-5-amino-2,3,3,4,4-pentadeuterio-5-oxopentanoic acid (CAS 14517-66-9) is a chemical compound with the molecular formula C7H12N2O4 and a molecular weight of 193.21 g/mol. IUPAC name: (2R)-2-acetamido-5-amino-2,3,3,4,4-pentadeuterio-5-oxopentanoic acid. InChIKey: KSMRODHGGIIXDV-WZERSISLSA-N.
| Molecular formula | C7H12N2O4 |
|---|---|
| Molecular weight | 193.21 g/mol |
| IUPAC name | (2R)-2-acetamido-5-amino-2,3,3,4,4-pentadeuterio-5-oxopentanoic acid |
| InChIKey | KSMRODHGGIIXDV-WZERSISLSA-N |
| SMILES | [2H][C@](C(=O)O)(C([2H])([2H])C([2H])([2H])C(=O)N)NC(=O)C |
Computed by PubChem (NCBI)