Products 1807938-29-9
CAS 1807938-29-9 is the registry number for (1-Amino-2-ethoxy-2-oxoethylidene)amino propanoate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
[(Z)-(1-amino-2-ethoxy-2-oxoethylidene)amino] propanoate (CAS 1807938-29-9) is a chemical compound with the molecular formula C7H12N2O4 and a molecular weight of 188.18 g/mol. IUPAC name: [(Z)-(1-amino-2-ethoxy-2-oxoethylidene)amino] propanoate. InChIKey: BZKIBWGEJBPOEC-UHFFFAOYSA-N.
| Molecular formula | C7H12N2O4 |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | [(Z)-(1-amino-2-ethoxy-2-oxoethylidene)amino] propanoate |
| InChIKey | BZKIBWGEJBPOEC-UHFFFAOYSA-N |
| SMILES | CCC(=O)O/N=C(/C(=O)OCC)\N |
Computed by PubChem (NCBI)