Products 197169-71-4
CAS 197169-71-4 is the registry number for 3-[[(2-Propen-1-yloxy)carbonyl]amino]-L-alanine, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
(2S)-2-amino-3-(prop-2-enoxycarbonylamino)propanoic acid (CAS 197169-71-4) is a chemical compound with the molecular formula C7H12N2O4 and a molecular weight of 188.18 g/mol. IUPAC name: (2S)-2-amino-3-(prop-2-enoxycarbonylamino)propanoic acid. InChIKey: PQKJHLXYNGBYQR-YFKPBYRVSA-N.
| Molecular formula | C7H12N2O4 |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | (2S)-2-amino-3-(prop-2-enoxycarbonylamino)propanoic acid |
| InChIKey | PQKJHLXYNGBYQR-YFKPBYRVSA-N |
| SMILES | C=CCOC(=O)NC[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)