Products 14341-82-3
CAS 14341-82-3 appears in our catalog under these names: Nalpha-Acetyl-DL-Glutamine-2,3,3,4,4-d5, 98 atom % D, min 90% Chemical Purity, Nalpha-Acetyl-DL-glutamine-2,3,3,4,4-d5. Offered by: CDN, MedChemExpress. Available pack sizes: 0,01g, 0,005g, 1mg, 5mg.
2-acetamido-5-amino-2,3,3,4,4-pentadeuterio-5-oxopentanoic acid (CAS 14341-82-3) is a chemical compound with the molecular formula C7H12N2O4 and a molecular weight of 193.21 g/mol. IUPAC name: 2-acetamido-5-amino-2,3,3,4,4-pentadeuterio-5-oxopentanoic acid. InChIKey: KSMRODHGGIIXDV-WHVBSWTDSA-N.
| Molecular formula | C7H12N2O4 |
|---|---|
| Molecular weight | 193.21 g/mol |
| IUPAC name | 2-acetamido-5-amino-2,3,3,4,4-pentadeuterio-5-oxopentanoic acid |
| InChIKey | KSMRODHGGIIXDV-WHVBSWTDSA-N |
| SMILES | [2H]C([2H])(C(=O)N)C([2H])([2H])C([2H])(C(=O)O)NC(=O)C |
Computed by PubChem (NCBI)