CAS 928220-68-2 is the registry number for (4S,5S)-2,2-Dimethyl-1,3-dioxolane-4,5-dicarboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4S,5S)-2,2-dimethyl-1,3-dioxolane-4,5-dicarboxamide (CAS 928220-68-2) is a chemical compound with the molecular formula C7H12N2O4 and a molecular weight of 188.18 g/mol. IUPAC name: (4S,5S)-2,2-dimethyl-1,3-dioxolane-4,5-dicarboxamide. InChIKey: YQPBXKXVZURPHT-IMJSIDKUSA-N.
| Molecular formula | C7H12N2O4 |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | (4S,5S)-2,2-dimethyl-1,3-dioxolane-4,5-dicarboxamide |
| InChIKey | YQPBXKXVZURPHT-IMJSIDKUSA-N |
| SMILES | CC1(O[C@@H]([C@H](O1)C(=O)N)C(=O)N)C |
Computed by PubChem (NCBI)