Products 145243-96-5
CAS 145243-96-5 appears in our catalog under these names: Butalbital-d5, Butalbital-d5 (allyl-d5), 98 atom % D, min 98% Chemical Purity, Butalbital-D5, 0.1mg/ml in Methanol, Butalbital-D5, 1mg/ml in Methanol, Butalbital-d5 solution. Offered by: TRC, Lipomed, CDN, Biosynth. Available pack sizes: 10mg, 1mg, 50mg, 100mg, 0,05g, 1ml, 10g, 5g.
5-(2-methylpropyl)-5-(1,1,2,3,3-pentadeuterioprop-2-enyl)-1,3-diazinane-2,4,6-trione (CAS 145243-96-5) is a chemical compound with the molecular formula C11H16N2O3 and a molecular weight of 229.29 g/mol. IUPAC name: 5-(2-methylpropyl)-5-(1,1,2,3,3-pentadeuterioprop-2-enyl)-1,3-diazinane-2,4,6-trione. InChIKey: UZVHFVZFNXBMQJ-MZTCHHLRSA-N.
| Molecular formula | C11H16N2O3 |
|---|---|
| Molecular weight | 229.29 g/mol |
| IUPAC name | 5-(2-methylpropyl)-5-(1,1,2,3,3-pentadeuterioprop-2-enyl)-1,3-diazinane-2,4,6-trione |
| InChIKey | UZVHFVZFNXBMQJ-MZTCHHLRSA-N |
| SMILES | [2H]C(=C([2H])C([2H])([2H])C1(C(=O)NC(=O)NC1=O)CC(C)C)[2H] |
Computed by PubChem (NCBI)