CAS 957494-04-1 is the registry number for Butalbital-13C4. Offered by: TRC. Available pack sizes: 10mg.
5-(2-methylpropyl)-5-prop-2-enyl-(2,4,5,6-13C4)1,3-diazinane-2,4,6-trione (CAS 957494-04-1) is a chemical compound with the molecular formula C11H16N2O3 and a molecular weight of 228.23 g/mol. IUPAC name: 5-(2-methylpropyl)-5-prop-2-enyl-(2,4,5,6-13C4)1,3-diazinane-2,4,6-trione. InChIKey: UZVHFVZFNXBMQJ-JQXHBQSKSA-N.
| Molecular formula | C11H16N2O3 |
|---|---|
| Molecular weight | 228.23 g/mol |
| IUPAC name | 5-(2-methylpropyl)-5-prop-2-enyl-(2,4,5,6-13C4)1,3-diazinane-2,4,6-trione |
| InChIKey | UZVHFVZFNXBMQJ-JQXHBQSKSA-N |
| SMILES | CC(C)C[13C]1([13C](=O)N[13C](=O)N[13C]1=O)CC=C |
Computed by PubChem (NCBI)