Products 1452565-52-4
CAS 1452565-52-4 is the registry number for 4-(Benzyloxy)-3-(methoxycarbonyl)benzenaminium chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(3-methoxycarbonyl-4-phenylmethoxyphenyl)azanium chloride (CAS 1452565-52-4) is a chemical compound with the molecular formula C15H16ClNO3 and a molecular weight of 293.74 g/mol. IUPAC name: (3-methoxycarbonyl-4-phenylmethoxyphenyl)azanium chloride. InChIKey: NGZADAQWUCTKNC-UHFFFAOYSA-N.
| Molecular formula | C15H16ClNO3 |
|---|---|
| Molecular weight | 293.74 g/mol |
| IUPAC name | (3-methoxycarbonyl-4-phenylmethoxyphenyl)azanium chloride |
| InChIKey | NGZADAQWUCTKNC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)[NH3+])OCC2=CC=CC=C2.[Cl-] |
Computed by PubChem (NCBI)