CAS 150351-64-7 appears in our catalog under these names: O-Phenyl-L-tyrosine hydrochloride, 97%, H-L-Tyr(Ph)-OH. Offered by: AmBeed, Iris Biotech. Available pack sizes: 1g, 50mg, 250mg.
(2S)-2-amino-3-(4-phenoxyphenyl)propanoic acid;hydrochloride (CAS 150351-64-7) is a chemical compound with the molecular formula C15H16ClNO3 and a molecular weight of 293.74 g/mol. IUPAC name: (2S)-2-amino-3-(4-phenoxyphenyl)propanoic acid;hydrochloride. InChIKey: JTNCAXKXGJBTRG-UQKRIMTDSA-N.
| Molecular formula | C15H16ClNO3 |
|---|---|
| Molecular weight | 293.74 g/mol |
| IUPAC name | (2S)-2-amino-3-(4-phenoxyphenyl)propanoic acid;hydrochloride |
| InChIKey | JTNCAXKXGJBTRG-UQKRIMTDSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)C[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)