Products 928149-17-1

CAS 928149-17-1 is the registry number for 7-Chloro-1-((tetrahydro-2h-pyran-4-yl)methyl)-1h-indole-3-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

7-chloro-1-(oxan-4-ylmethyl)indole-3-carboxylic acid (CAS 928149-17-1) is a chemical compound with the molecular formula C15H16ClNO3 and a molecular weight of 293.74 g/mol. IUPAC name: 7-chloro-1-(oxan-4-ylmethyl)indole-3-carboxylic acid. InChIKey: WPBDEEPIHAYJMO-UHFFFAOYSA-N.

Identity
Molecular formulaC15H16ClNO3
Molecular weight293.74 g/mol
IUPAC name7-chloro-1-(oxan-4-ylmethyl)indole-3-carboxylic acid
InChIKeyWPBDEEPIHAYJMO-UHFFFAOYSA-N
SMILESC1COCCC1CN2C=C(C3=C2C(=CC=C3)Cl)C(=O)O

Computed by PubChem (NCBI)