Products 928215-97-8
CAS 928215-97-8 is the registry number for tert-Butyl 4-(4-chlorophenyl)-2-oxo-2,5-dihydro-1h-pyrrole-1-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Tert-butyl 3-(4-chlorophenyl)-5-oxo-2H-pyrrole-1-carboxylate (CAS 928215-97-8) is a chemical compound with the molecular formula C15H16ClNO3 and a molecular weight of 293.74 g/mol. IUPAC name: tert-butyl 3-(4-chlorophenyl)-5-oxo-2H-pyrrole-1-carboxylate. InChIKey: RVTNSVQBHKTRFB-UHFFFAOYSA-N.
| Molecular formula | C15H16ClNO3 |
|---|---|
| Molecular weight | 293.74 g/mol |
| IUPAC name | tert-butyl 3-(4-chlorophenyl)-5-oxo-2H-pyrrole-1-carboxylate |
| InChIKey | RVTNSVQBHKTRFB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(=CC1=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)