CAS 1453266-30-2 is the registry number for 2-(N-Hydroxyimino)-N-(2,3,4-trifluorophenyl)acetamide. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
(2E)-2-hydroxyimino-N-(2,3,4-trifluorophenyl)acetamide (CAS 1453266-30-2) is a chemical compound with the molecular formula C8H5F3N2O2 and a molecular weight of 218.13 g/mol. IUPAC name: (2E)-2-hydroxyimino-N-(2,3,4-trifluorophenyl)acetamide. InChIKey: DSLHOZVFNXOCDR-KGVSQERTSA-N.
| Molecular formula | C8H5F3N2O2 |
|---|---|
| Molecular weight | 218.13 g/mol |
| IUPAC name | (2E)-2-hydroxyimino-N-(2,3,4-trifluorophenyl)acetamide |
| InChIKey | DSLHOZVFNXOCDR-KGVSQERTSA-N |
| SMILES | C1=CC(=C(C(=C1NC(=O)/C=N/O)F)F)F |
Computed by PubChem (NCBI)