CAS 1806318-94-4 appears in our catalog under these names: 5-(trifluoromethoxy)-1,3-benzoxazol-2-amine, 95%, 5-(Trifluoromethoxy)-1,3-benzoxazol-2-amine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 100mg.
5-(trifluoromethoxy)-1,3-benzoxazol-2-amine (CAS 1806318-94-4) is a chemical compound with the molecular formula C8H5F3N2O2 and a molecular weight of 218.13 g/mol. IUPAC name: 5-(trifluoromethoxy)-1,3-benzoxazol-2-amine. InChIKey: KOOOWQOQBUXAFS-UHFFFAOYSA-N.
| Molecular formula | C8H5F3N2O2 |
|---|---|
| Molecular weight | 218.13 g/mol |
| IUPAC name | 5-(trifluoromethoxy)-1,3-benzoxazol-2-amine |
| InChIKey | KOOOWQOQBUXAFS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1OC(F)(F)F)N=C(O2)N |
Computed by PubChem (NCBI)