CAS 1992027-94-7 is the registry number for 2-(Trifluoromethyl)-1H-benzo[d]imidazole-5,6-diol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(trifluoromethyl)-1H-benzimidazole-5,6-diol (CAS 1992027-94-7) is a chemical compound with the molecular formula C8H5F3N2O2 and a molecular weight of 218.13 g/mol. IUPAC name: 2-(trifluoromethyl)-1H-benzimidazole-5,6-diol. InChIKey: UCLVZXHCCLUCCY-UHFFFAOYSA-N.
| Molecular formula | C8H5F3N2O2 |
|---|---|
| Molecular weight | 218.13 g/mol |
| IUPAC name | 2-(trifluoromethyl)-1H-benzimidazole-5,6-diol |
| InChIKey | UCLVZXHCCLUCCY-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1O)O)N=C(N2)C(F)(F)F |
Computed by PubChem (NCBI)