CAS 1806501-06-3 appears in our catalog under these names: 7-(trifluoromethoxy)-1,3-benzoxazol-2-amine, 96%, 7-(Trifluoromethoxy)-1,3-benzoxazol-2-amine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 100mg, 250mg.
7-(trifluoromethoxy)-1,3-benzoxazol-2-amine (CAS 1806501-06-3) is a chemical compound with the molecular formula C8H5F3N2O2 and a molecular weight of 218.13 g/mol. IUPAC name: 7-(trifluoromethoxy)-1,3-benzoxazol-2-amine. InChIKey: GEZBQDWRZXGYPC-UHFFFAOYSA-N.
| Molecular formula | C8H5F3N2O2 |
|---|---|
| Molecular weight | 218.13 g/mol |
| IUPAC name | 7-(trifluoromethoxy)-1,3-benzoxazol-2-amine |
| InChIKey | GEZBQDWRZXGYPC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)OC(F)(F)F)OC(=N2)N |
Computed by PubChem (NCBI)