CAS 1453315-99-5 appears in our catalog under these names: tert-Butyl 8-hydroxy-5-oxa-2-azaspiro(3.4)octane-2-carboxylate, 98%, tert-Butyl-8-hydroxy-5-oxa-2-azaspiro(3.4)octane-2-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 0,5g, 50mg.
Tert-butyl 8-hydroxy-5-oxa-2-azaspiro[3.4]octane-2-carboxylate (CAS 1453315-99-5) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: tert-butyl 8-hydroxy-5-oxa-2-azaspiro[3.4]octane-2-carboxylate. InChIKey: AUOIOKGLSQZUQZ-UHFFFAOYSA-N.
| Molecular formula | C11H19NO4 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | tert-butyl 8-hydroxy-5-oxa-2-azaspiro[3.4]octane-2-carboxylate |
| InChIKey | AUOIOKGLSQZUQZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)C(CCO2)O |
Computed by PubChem (NCBI)