CAS 145362-72-7 is the registry number for Benzyl N-(Diphenylmethylene)-L-serinate. Offered by: TRC. Available pack sizes: 1g, 2g, 500mg.
Benzyl (2S)-2-(benzhydrylideneamino)-3-hydroxypropanoate (CAS 145362-72-7) is a chemical compound with the molecular formula C23H21NO3 and a molecular weight of 359.4 g/mol. IUPAC name: benzyl (2S)-2-(benzhydrylideneamino)-3-hydroxypropanoate. InChIKey: VPAWZKGPNOLUAC-NRFANRHFSA-N.
| Molecular formula | C23H21NO3 |
|---|---|
| Molecular weight | 359.4 g/mol |
| IUPAC name | benzyl (2S)-2-(benzhydrylideneamino)-3-hydroxypropanoate |
| InChIKey | VPAWZKGPNOLUAC-NRFANRHFSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)[C@H](CO)N=C(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)