CAS 215178-44-2 appears in our catalog under these names: Fmoc-l-phenylglycinol, 98%, (S)-(9H-Fluoren-9-yl)methyl (2-hydroxy-1-phenylethyl)carbamate, 97%, Fmoc–L–Phenylglycinol, Fmoc-L-Phenylglycinol, 98%, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat. Available pack sizes: 1g, 25g, 5g.
9H-fluoren-9-ylmethyl N-[(1S)-2-hydroxy-1-phenylethyl]carbamate (CAS 215178-44-2) is a chemical compound with the molecular formula C23H21NO3 and a molecular weight of 359.4 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-[(1S)-2-hydroxy-1-phenylethyl]carbamate. InChIKey: CATSPGUSOQBNRU-JOCHJYFZSA-N.
| Molecular formula | C23H21NO3 |
|---|---|
| Molecular weight | 359.4 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-[(1S)-2-hydroxy-1-phenylethyl]carbamate |
| InChIKey | CATSPGUSOQBNRU-JOCHJYFZSA-N |
| SMILES | C1=CC=C(C=C1)[C@@H](CO)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)