Products 65707-83-7
CAS 65707-83-7 appears in our catalog under these names: 2-Diphenylacetylamino-3-phenyl-propionic acid, 95%, 2-(2,2-Diphenylacetamido)-3-phenylpropanoic acid, 95%, 2-(2,2-Diphenylacetamido)-3-phenylpropanoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
2-[(2,2-diphenylacetyl)amino]-3-phenylpropanoic acid (CAS 65707-83-7) is a chemical compound with the molecular formula C23H21NO3 and a molecular weight of 359.4 g/mol. IUPAC name: 2-[(2,2-diphenylacetyl)amino]-3-phenylpropanoic acid. InChIKey: QVEDURKSSUBWSO-UHFFFAOYSA-N.
| Molecular formula | C23H21NO3 |
|---|---|
| Molecular weight | 359.4 g/mol |
| IUPAC name | 2-[(2,2-diphenylacetyl)amino]-3-phenylpropanoic acid |
| InChIKey | QVEDURKSSUBWSO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(C(=O)O)NC(=O)C(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)