CAS 848256-17-7 appears in our catalog under these names: AIMP2-DX2-IN-1, 98%, AIMP2-DX2-IN-1/ 99.53% (existing batch purity), AIMP2–DX2–IN–1, AIMP2-DX2-IN-1 99%, AIMP2-DX2-IN-1, 98%, 98%. Offered by: AmBeed, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 250mg, 10 mg.
N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-2-(4-phenylphenyl)acetamide (CAS 848256-17-7) is a chemical compound with the molecular formula C23H21NO3 and a molecular weight of 359.4 g/mol. IUPAC name: N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-2-(4-phenylphenyl)acetamide. InChIKey: HBQISKIXXNULAI-UHFFFAOYSA-N.
| Molecular formula | C23H21NO3 |
|---|---|
| Molecular weight | 359.4 g/mol |
| IUPAC name | N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-2-(4-phenylphenyl)acetamide |
| InChIKey | HBQISKIXXNULAI-UHFFFAOYSA-N |
| SMILES | C1C(OC2=CC=CC=C2O1)CNC(=O)CC3=CC=C(C=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)