CAS 1453860-99-5 appears in our catalog under these names: Ethyl 2-methyl-5-nitrobenzoate, 97%, 97%, 4,4,5,5-tetramethyl-2-[4-(3-methyloxetan-3-yl)phenyl]-1,3,2-dioxaborolane, 95%. Offered by: Chemat, Chemat Brand. Available pack sizes: 100mg, 250mg, 500mg, 1g, on request.
4,4,5,5-tetramethyl-2-[4-(3-methyloxetan-3-yl)phenyl]-1,3,2-dioxaborolane (CAS 1453860-99-5) is a chemical compound with the molecular formula C16H23BO3 and a molecular weight of 274.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[4-(3-methyloxetan-3-yl)phenyl]-1,3,2-dioxaborolane. InChIKey: HVZJSKWSPAFLGM-UHFFFAOYSA-N.
| Molecular formula | C16H23BO3 |
|---|---|
| Molecular weight | 274.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[4-(3-methyloxetan-3-yl)phenyl]-1,3,2-dioxaborolane |
| InChIKey | HVZJSKWSPAFLGM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C3(COC3)C |
Computed by PubChem (NCBI)