CAS 145416-37-1 is the registry number for Lamivudine Impurity 16 (alpha-Troxacitabine). Offered by: Chemat Brand. Available pack sizes: on request.
4-amino-1-[(2S,4R)-2-(hydroxymethyl)-1,3-dioxolan-4-yl]pyrimidin-2-one (CAS 145416-37-1) is a chemical compound with the molecular formula C8H11N3O4 and a molecular weight of 213.19 g/mol. IUPAC name: 4-amino-1-[(2S,4R)-2-(hydroxymethyl)-1,3-dioxolan-4-yl]pyrimidin-2-one. InChIKey: RXRGZNYSEHTMHC-RQJHMYQMSA-N.
| Molecular formula | C8H11N3O4 |
|---|---|
| Molecular weight | 213.19 g/mol |
| IUPAC name | 4-amino-1-[(2S,4R)-2-(hydroxymethyl)-1,3-dioxolan-4-yl]pyrimidin-2-one |
| InChIKey | RXRGZNYSEHTMHC-RQJHMYQMSA-N |
| SMILES | C1[C@@H](O[C@H](O1)CO)N2C=CC(=NC2=O)N |
Computed by PubChem (NCBI)