Products 1454690-50-6
CAS 1454690-50-6 is the registry number for 2,4-Difluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4-difluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (CAS 1454690-50-6) is a chemical compound with the molecular formula C12H16BF2NO2 and a molecular weight of 255.07 g/mol. IUPAC name: 2,4-difluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline. InChIKey: CEZAYDABERBMBI-UHFFFAOYSA-N.
| Molecular formula | C12H16BF2NO2 |
|---|---|
| Molecular weight | 255.07 g/mol |
| IUPAC name | 2,4-difluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| InChIKey | CEZAYDABERBMBI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2F)F)N |
Computed by PubChem (NCBI)