CAS 1704069-62-4 is the registry number for (2,3–Difluoro–4–(4–methylpiperidin–1–yl)phenyl)boronic acid. Offered by: GLPBio. Available pack sizes: 1g.
[2,3-difluoro-4-(4-methylpiperidin-1-yl)phenyl]boronic acid (CAS 1704069-62-4) is a chemical compound with the molecular formula C12H16BF2NO2 and a molecular weight of 255.07 g/mol. IUPAC name: [2,3-difluoro-4-(4-methylpiperidin-1-yl)phenyl]boronic acid. InChIKey: DJEHDFUPGWWFGH-UHFFFAOYSA-N.
| Molecular formula | C12H16BF2NO2 |
|---|---|
| Molecular weight | 255.07 g/mol |
| IUPAC name | [2,3-difluoro-4-(4-methylpiperidin-1-yl)phenyl]boronic acid |
| InChIKey | DJEHDFUPGWWFGH-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)N2CCC(CC2)C)F)F)(O)O |
Computed by PubChem (NCBI)