Products 1701449-93-5
CAS 1701449-93-5 is the registry number for 3-Amino-4,5-difluorophenylboronic acid, pinacol ester, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2,3-difluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (CAS 1701449-93-5) is a chemical compound with the molecular formula C12H16BF2NO2 and a molecular weight of 255.07 g/mol. IUPAC name: 2,3-difluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline. InChIKey: AYBZQVJYXVNTAD-UHFFFAOYSA-N.
| Molecular formula | C12H16BF2NO2 |
|---|---|
| Molecular weight | 255.07 g/mol |
| IUPAC name | 2,3-difluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| InChIKey | AYBZQVJYXVNTAD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C(=C2)F)F)N |
Computed by PubChem (NCBI)