CAS 1704067-16-2 is the registry number for (3,4–Difluoro–5–(4–methylpiperidin– 1–yl)phenyl)boronic acid. Offered by: GLPBio. Available pack sizes: 1g.
[3,4-difluoro-5-(4-methylpiperidin-1-yl)phenyl]boronic acid (CAS 1704067-16-2) is a chemical compound with the molecular formula C12H16BF2NO2 and a molecular weight of 255.07 g/mol. IUPAC name: [3,4-difluoro-5-(4-methylpiperidin-1-yl)phenyl]boronic acid. InChIKey: LDOSUNQKCJAJGV-UHFFFAOYSA-N.
| Molecular formula | C12H16BF2NO2 |
|---|---|
| Molecular weight | 255.07 g/mol |
| IUPAC name | [3,4-difluoro-5-(4-methylpiperidin-1-yl)phenyl]boronic acid |
| InChIKey | LDOSUNQKCJAJGV-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)F)F)N2CCC(CC2)C)(O)O |
Computed by PubChem (NCBI)