CAS 145544-92-9 is the registry number for 4-Ethenylbenzenemethanesulfonyl Chloride. Offered by: TRC. Available pack sizes: 1g.
(4-ethenylphenyl)methanesulfonyl chloride (CAS 145544-92-9) is a chemical compound with the molecular formula C9H9ClO2S and a molecular weight of 216.68 g/mol. IUPAC name: (4-ethenylphenyl)methanesulfonyl chloride. InChIKey: XGASBMPNSZVUOS-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO2S |
|---|---|
| Molecular weight | 216.68 g/mol |
| IUPAC name | (4-ethenylphenyl)methanesulfonyl chloride |
| InChIKey | XGASBMPNSZVUOS-UHFFFAOYSA-N |
| SMILES | C=CC1=CC=C(C=C1)CS(=O)(=O)Cl |
Computed by PubChem (NCBI)