CAS 1457594-17-0 is the registry number for 1-((2,6-Difluorophenyl)carbamoyl)cyclopropane-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
1-[(2,6-difluorophenyl)carbamoyl]cyclopropane-1-carboxylic acid (CAS 1457594-17-0) is a chemical compound with the molecular formula C11H9F2NO3 and a molecular weight of 241.19 g/mol. IUPAC name: 1-[(2,6-difluorophenyl)carbamoyl]cyclopropane-1-carboxylic acid. InChIKey: HHZNJFSZPFMZLL-UHFFFAOYSA-N.
| Molecular formula | C11H9F2NO3 |
|---|---|
| Molecular weight | 241.19 g/mol |
| IUPAC name | 1-[(2,6-difluorophenyl)carbamoyl]cyclopropane-1-carboxylic acid |
| InChIKey | HHZNJFSZPFMZLL-UHFFFAOYSA-N |
| SMILES | C1CC1(C(=O)NC2=C(C=CC=C2F)F)C(=O)O |
Computed by PubChem (NCBI)