Products 1457594-17-0

CAS 1457594-17-0 is the registry number for 1-((2,6-Difluorophenyl)carbamoyl)cyclopropane-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

1-[(2,6-difluorophenyl)carbamoyl]cyclopropane-1-carboxylic acid (CAS 1457594-17-0) is a chemical compound with the molecular formula C11H9F2NO3 and a molecular weight of 241.19 g/mol. IUPAC name: 1-[(2,6-difluorophenyl)carbamoyl]cyclopropane-1-carboxylic acid. InChIKey: HHZNJFSZPFMZLL-UHFFFAOYSA-N.

Identity
Molecular formulaC11H9F2NO3
Molecular weight241.19 g/mol
IUPAC name1-[(2,6-difluorophenyl)carbamoyl]cyclopropane-1-carboxylic acid
InChIKeyHHZNJFSZPFMZLL-UHFFFAOYSA-N
SMILESC1CC1(C(=O)NC2=C(C=CC=C2F)F)C(=O)O

Computed by PubChem (NCBI)