Products 831191-80-1
CAS 831191-80-1 is the registry number for 2-Propenoic acid,2-(acetylamino)-3-(2,4-difluorophenyl)-, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
2-acetamido-3-(2,4-difluorophenyl)prop-2-enoic acid (CAS 831191-80-1) is a chemical compound with the molecular formula C11H9F2NO3 and a molecular weight of 241.19 g/mol. IUPAC name: 2-acetamido-3-(2,4-difluorophenyl)prop-2-enoic acid. InChIKey: MHJWKVCDAUVXOM-UHFFFAOYSA-N.
| Molecular formula | C11H9F2NO3 |
|---|---|
| Molecular weight | 241.19 g/mol |
| IUPAC name | 2-acetamido-3-(2,4-difluorophenyl)prop-2-enoic acid |
| InChIKey | MHJWKVCDAUVXOM-UHFFFAOYSA-N |
| SMILES | CC(=O)NC(=CC1=C(C=C(C=C1)F)F)C(=O)O |
Computed by PubChem (NCBI)