Products 496941-62-9
CAS 496941-62-9 is the registry number for 1-(3,4-Difluorophenyl)-5-oxopyrrolidine-3-carboxylic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 25g, 10g.
1-(3,4-difluorophenyl)-5-oxopyrrolidine-3-carboxylic acid (CAS 496941-62-9) is a chemical compound with the molecular formula C11H9F2NO3 and a molecular weight of 241.19 g/mol. IUPAC name: 1-(3,4-difluorophenyl)-5-oxopyrrolidine-3-carboxylic acid. InChIKey: ZONVRPYTUSSRDE-UHFFFAOYSA-N.
| Molecular formula | C11H9F2NO3 |
|---|---|
| Molecular weight | 241.19 g/mol |
| IUPAC name | 1-(3,4-difluorophenyl)-5-oxopyrrolidine-3-carboxylic acid |
| InChIKey | ZONVRPYTUSSRDE-UHFFFAOYSA-N |
| SMILES | C1C(CN(C1=O)C2=CC(=C(C=C2)F)F)C(=O)O |
Computed by PubChem (NCBI)