CAS 91596-54-2 is the registry number for 1-(2,2-Difluorobenzo[d][1,3]dioxol-5-yl)pyrrolidin-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(2,2-difluoro-1,3-benzodioxol-5-yl)pyrrolidin-2-one (CAS 91596-54-2) is a chemical compound with the molecular formula C11H9F2NO3 and a molecular weight of 241.19 g/mol. IUPAC name: 1-(2,2-difluoro-1,3-benzodioxol-5-yl)pyrrolidin-2-one. InChIKey: ZSHYVKKILYGAKJ-UHFFFAOYSA-N.
| Molecular formula | C11H9F2NO3 |
|---|---|
| Molecular weight | 241.19 g/mol |
| IUPAC name | 1-(2,2-difluoro-1,3-benzodioxol-5-yl)pyrrolidin-2-one |
| InChIKey | ZSHYVKKILYGAKJ-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1)C2=CC3=C(C=C2)OC(O3)(F)F |
Computed by PubChem (NCBI)