Products 14580-01-9

CAS 14580-01-9 appears in our catalog under these names: N–Anilinosuccinamic acid, Butanedioic acid 1-(2-phenylhydrazide), 97%, 97%. Offered by: GLPBio, Chemat. Available pack sizes: 50mg, 100mg.

Structural formula: {0} (CAS {1})

4-oxo-4-(2-phenylhydrazinyl)butanoic acid (CAS 14580-01-9) is a chemical compound with the molecular formula C10H12N2O3 and a molecular weight of 208.21 g/mol. IUPAC name: 4-oxo-4-(2-phenylhydrazinyl)butanoic acid. InChIKey: MKYYUGVTLSBAPZ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H12N2O3
Molecular weight208.21 g/mol
IUPAC name4-oxo-4-(2-phenylhydrazinyl)butanoic acid
InChIKeyMKYYUGVTLSBAPZ-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)NNC(=O)CCC(=O)O

Computed by PubChem (NCBI)